C29H45N2O2+ — CID 67825074
(1S,3aS,3bR,5aR,9aR,9bS,11aS)-N-(2-adamantyl)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,8,9,9b,10,11-tetradecahydroindeno[5,4-f]isoquinolin-7-ium-1-carboxamide (PubChem CID 67825074) has the molecular formula C29H45N2O2+ and a molecular weight of 453.69 g/mol. Its IUPAC name is (1S,3aS,3bR,5aR,9aR,9bS,11aS)-N-(2-adamantyl)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,8,9,9b,10,11-tetradecahydroindeno[5,4-f]isoquinolin-7-ium-1-carboxamide.
| Compound Name | (1S,3aS,3bR,5aR,9aR,9bS,11aS)-N-(2-adamantyl)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,8,9,9b,10,11-tetradecahydroindeno[5,4-f]isoquinolin-7-ium-1-carboxamide |
|---|---|
| PubChem CID | 67825074 |
| Molecular Formula | C29H45N2O2+ |
| Molecular Weight | 453.69 g/mol |
| Exact Mass | 453.35 |
| IUPAC Name | (1S,3aS,3bR,5aR,9aR,9bS,11aS)-N-(2-adamantyl)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,8,9,9b,10,11-tetradecahydroindeno[5,4-f]isoquinolin-7-ium-1-carboxamide |
| SMILES | C[C@]12CC[N+](=O)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](C(=O)NC3C4CC5CC(C4)CC3C5)CC[C@@H]12 |
| InChI | InChI=1S/C29H44N2O2/c1-28-9-10-31(33)16-21(28)3-4-22-23-5-6-25(29(23,2)8-7-24(22)28)27(32)30-26-19-12-17-11-18(14-19)15-20(26)13-17/h17-26H,3-16H2,1-2H3/p+1/t17?,18?,19?,20?,21-,22-,23-,24-,25+,26?,28-,29-/m0/s1 |
| InChIKey | YLMQGRRIICDMRN-YTOVUESHSA-O |
| XLogP | 5.58 |
| TPSA | 49.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.69 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|