C20H30F2O5 — CID 67825158
(3aR,4R,5R)-4-(4,4-difluoro-5-oxooctyl)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 67825158) has the molecular formula C20H30F2O5 and a molecular weight of 388.45 g/mol. Its IUPAC name is (3aR,4R,5R)-4-(4,4-difluoro-5-oxooctyl)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R)-4-(4,4-difluoro-5-oxooctyl)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 67825158 |
| Molecular Formula | C20H30F2O5 |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | (3aR,4R,5R)-4-(4,4-difluoro-5-oxooctyl)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCC(=O)C(F)(F)CCC[C@H]1[C@H](OC2CCCCO2)CC2OC(=O)C[C@@H]21 |
| InChI | InChI=1S/C20H30F2O5/c1-2-6-17(23)20(21,22)9-5-7-13-14-11-18(24)26-16(14)12-15(13)27-19-8-3-4-10-25-19/h13-16,19H,2-12H2,1H3/t13-,14-,15-,16?,19?/m1/s1 |
| InChIKey | FTCKOEKJNDVBJD-VMBWPTMVSA-N |
| XLogP | 4.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |