About (2S)-2-amino-3-methylbutanoic acid;6-amino-1H-pyrimidin-2-one
(2S)-2-amino-3-methylbutanoic acid;6-amino-1H-pyrimidin-2-one (PubChem CID 67825262) has the molecular formula C9H16N4O3
and a molecular weight of 228.25 g/mol. Its IUPAC name is (2S)-2-amino-3-methylbutanoic acid;6-amino-1H-pyrimidin-2-one.
Molecular Properties
| Compound Name | (2S)-2-amino-3-methylbutanoic acid;6-amino-1H-pyrimidin-2-one |
| PubChem CID | 67825262 |
| Molecular Formula | C9H16N4O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | (2S)-2-amino-3-methylbutanoic acid;6-amino-1H-pyrimidin-2-one |
| SMILES | CC(C)[C@H](N)C(=O)O.Nc1ccnc(=O)[nH]1 |
| InChI | InChI=1S/C5H11NO2.C4H5N3O/c1-3(2)4(6)5(7)8;5-3-1-2-6-4(8)7-3/h3-4H,6H2,1-2H3,(H,7,8);1-2H,(H3,5,6,7,8)/t4-;/m0./s1 |
| InChIKey | SVWVVHQNPONVHZ-WCCKRBBISA-N |
| XLogP | -0.59 |
| TPSA | 135.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-amino-3-methylbutanoic acid;6-amino-1H-pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3-methylbutanoic acid;6-amino-1H-pyrimidin-2-one?
The IUPAC name of (2S)-2-amino-3-methylbutanoic acid;6-amino-1H-pyrimidin-2-one (CID 67825262) is (2S)-2-amino-3-methylbutanoic acid;6-amino-1H-pyrimidin-2-one.
What is the SMILES notation for (2S)-2-amino-3-methylbutanoic acid;6-amino-1H-pyrimidin-2-one?
The canonical SMILES for (2S)-2-amino-3-methylbutanoic acid;6-amino-1H-pyrimidin-2-one is CC(C)[C@H](N)C(=O)O.Nc1ccnc(=O)[nH]1.
What is the InChIKey of (2S)-2-amino-3-methylbutanoic acid;6-amino-1H-pyrimidin-2-one?
The InChIKey is SVWVVHQNPONVHZ-WCCKRBBISA-N. The full InChI is InChI=1S/C5H11NO2.C4H5N3O/c1-3(2)4(6)5(7)8;5-3-1-2-6-4(8)7-3/h3-4H,6H2,1-2H3,(H,7,8);1-2H,(H3,5,6,7,8)/t4-;/m0./s1.
What are the key properties of (2S)-2-amino-3-methylbutanoic acid;6-amino-1H-pyrimidin-2-one?
(2S)-2-amino-3-methylbutanoic acid;6-amino-1H-pyrimidin-2-one has a molecular weight of 228.25 g/mol, XLogP of -0.59, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-methylbutanoic acid;6-amino-1H-pyrimidin-2-one is sourced from PubChem (CID 67825262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).