About 2-[[[(2S,3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl]amino]methyl]pyridin-3-ol
2-[[[(2S,3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl]amino]methyl]pyridin-3-ol (PubChem CID 67825542) has the molecular formula C26H29N3O
and a molecular weight of 399.54 g/mol. Its IUPAC name is 2-[[[(2S,3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl]amino]methyl]pyridin-3-ol.
Molecular Properties
| Compound Name | 2-[[[(2S,3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl]amino]methyl]pyridin-3-ol |
| PubChem CID | 67825542 |
| Molecular Formula | C26H29N3O |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | 2-[[[(2S,3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl]amino]methyl]pyridin-3-ol |
| SMILES | Oc1cccnc1CN[C@@H]1C2CCN(CC2)[C@H]1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H29N3O/c30-23-12-7-15-27-22(23)18-28-25-21-13-16-29(17-14-21)26(25)24(19-8-3-1-4-9-19)20-10-5-2-6-11-20/h1-12,15,21,24-26,28,30H,13-14,16-18H2/t25-,26+/m1/s1 |
| InChIKey | DOHHBIPECQELEM-FTJBHMTQSA-N |
| XLogP | 4.17 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[[(2S,3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl]amino]methyl]pyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[[(2S,3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl]amino]methyl]pyridin-3-ol?
The IUPAC name of 2-[[[(2S,3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl]amino]methyl]pyridin-3-ol (CID 67825542) is 2-[[[(2S,3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl]amino]methyl]pyridin-3-ol.
What is the SMILES notation for 2-[[[(2S,3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl]amino]methyl]pyridin-3-ol?
The canonical SMILES for 2-[[[(2S,3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl]amino]methyl]pyridin-3-ol is Oc1cccnc1CN[C@@H]1C2CCN(CC2)[C@H]1C(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-[[[(2S,3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl]amino]methyl]pyridin-3-ol?
The InChIKey is DOHHBIPECQELEM-FTJBHMTQSA-N. The full InChI is InChI=1S/C26H29N3O/c30-23-12-7-15-27-22(23)18-28-25-21-13-16-29(17-14-21)26(25)24(19-8-3-1-4-9-19)20-10-5-2-6-11-20/h1-12,15,21,24-26,28,30H,13-14,16-18H2/t25-,26+/m1/s1.
What are the key properties of 2-[[[(2S,3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl]amino]methyl]pyridin-3-ol?
2-[[[(2S,3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl]amino]methyl]pyridin-3-ol has a molecular weight of 399.54 g/mol, XLogP of 4.17, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[[(2S,3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-yl]amino]methyl]pyridin-3-ol is sourced from PubChem (CID 67825542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).