About 3-azatricyclo[5.4.0.02,6]undeca-1(11),2(6),4,7,9-pentaene
3-azatricyclo[5.4.0.02,6]undeca-1(11),2(6),4,7,9-pentaene (PubChem CID 67825781) has the molecular formula C10H7N
and a molecular weight of 141.17 g/mol. Its IUPAC name is 3-azatricyclo[5.4.0.02,6]undeca-1(11),2(6),4,7,9-pentaene.
Analyze 3-azatricyclo[5.4.0.02,6]undeca-1(11),2(6),4,7,9-pentaene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azatricyclo[5.4.0.02,6]undeca-1(11),2(6),4,7,9-pentaene?
The IUPAC name of 3-azatricyclo[5.4.0.02,6]undeca-1(11),2(6),4,7,9-pentaene (CID 67825781) is 3-azatricyclo[5.4.0.02,6]undeca-1(11),2(6),4,7,9-pentaene.
What is the SMILES notation for 3-azatricyclo[5.4.0.02,6]undeca-1(11),2(6),4,7,9-pentaene?
The canonical SMILES for 3-azatricyclo[5.4.0.02,6]undeca-1(11),2(6),4,7,9-pentaene is c1ccc2c(c1)-c1cc[nH]c1-2.
What is the InChIKey of 3-azatricyclo[5.4.0.02,6]undeca-1(11),2(6),4,7,9-pentaene?
The InChIKey is IGGOTCIVCKFXMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N/c1-2-4-8-7(3-1)9-5-6-11-10(8)9/h1-6,11H.
What are the key properties of 3-azatricyclo[5.4.0.02,6]undeca-1(11),2(6),4,7,9-pentaene?
3-azatricyclo[5.4.0.02,6]undeca-1(11),2(6),4,7,9-pentaene has a molecular weight of 141.17 g/mol, XLogP of 2.66, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azatricyclo[5.4.0.02,6]undeca-1(11),2(6),4,7,9-pentaene is sourced from PubChem (CID 67825781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).