About 1-(dimethylamino)-6-propylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride
1-(dimethylamino)-6-propylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride (PubChem CID 67825841) has the molecular formula C12H20ClNO2
and a molecular weight of 245.75 g/mol. Its IUPAC name is 1-(dimethylamino)-6-propylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 1-(dimethylamino)-6-propylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride |
| PubChem CID | 67825841 |
| Molecular Formula | C12H20ClNO2 |
| Molecular Weight | 245.75 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 1-(dimethylamino)-6-propylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride |
| SMILES | CCCC1C=CC=CC1(C(=O)O)N(C)C.Cl |
| InChI | InChI=1S/C12H19NO2.ClH/c1-4-7-10-8-5-6-9-12(10,11(14)15)13(2)3;/h5-6,8-10H,4,7H2,1-3H3,(H,14,15);1H |
| InChIKey | NFORQOLNACKQHG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.75 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(dimethylamino)-6-propylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)-6-propylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride?
The IUPAC name of 1-(dimethylamino)-6-propylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride (CID 67825841) is 1-(dimethylamino)-6-propylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride.
What is the SMILES notation for 1-(dimethylamino)-6-propylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride?
The canonical SMILES for 1-(dimethylamino)-6-propylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride is CCCC1C=CC=CC1(C(=O)O)N(C)C.Cl.
What is the InChIKey of 1-(dimethylamino)-6-propylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride?
The InChIKey is NFORQOLNACKQHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2.ClH/c1-4-7-10-8-5-6-9-12(10,11(14)15)13(2)3;/h5-6,8-10H,4,7H2,1-3H3,(H,14,15);1H.
What are the key properties of 1-(dimethylamino)-6-propylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride?
1-(dimethylamino)-6-propylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride has a molecular weight of 245.75 g/mol, XLogP of 2.34, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)-6-propylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride is sourced from PubChem (CID 67825841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).