C15H18N2O4S2 — CID 67826252
2,9,12-trimethyltricyclo[5.2.2.12,6]dodeca-1(10),4,6(12),7(11),8-pentaene-8,11-disulfonamide (PubChem CID 67826252) has the molecular formula C15H18N2O4S2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 2,9,12-trimethyltricyclo[5.2.2.12,6]dodeca-1(10),4,6(12),7(11),8-pentaene-8,11-disulfonamide.
| Compound Name | 2,9,12-trimethyltricyclo[5.2.2.12,6]dodeca-1(10),4,6(12),7(11),8-pentaene-8,11-disulfonamide |
|---|---|
| PubChem CID | 67826252 |
| Molecular Formula | C15H18N2O4S2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 2,9,12-trimethyltricyclo[5.2.2.12,6]dodeca-1(10),4,6(12),7(11),8-pentaene-8,11-disulfonamide |
| SMILES | CC1=C2C=CCC1(C)c1cc(S(N)(=O)=O)c2c(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C15H18N2O4S2/c1-8-11-7-12(22(16,18)19)13(14(8)23(17,20)21)10-5-4-6-15(11,3)9(10)2/h4-5,7H,6H2,1-3H3,(H2,16,18,19)(H2,17,20,21) |
| InChIKey | XTSSQWYENAKGIV-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |