About 1,2-dihydrobenzo[e][1,3]benzoxazole
1,2-dihydrobenzo[e][1,3]benzoxazole (PubChem CID 67826426) has the molecular formula C11H9NO
and a molecular weight of 171.20 g/mol. Its IUPAC name is 1,2-dihydrobenzo[e][1,3]benzoxazole.
Molecular Properties
| Compound Name | 1,2-dihydrobenzo[e][1,3]benzoxazole |
| PubChem CID | 67826426 |
| Molecular Formula | C11H9NO |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 1,2-dihydrobenzo[e][1,3]benzoxazole |
| SMILES | c1ccc2c3c(ccc2c1)OCN3 |
| InChI | InChI=1S/C11H9NO/c1-2-4-9-8(3-1)5-6-10-11(9)12-7-13-10/h1-6,12H,7H2 |
| InChIKey | JIKBWQQDHWHMBA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-dihydrobenzo[e][1,3]benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydrobenzo[e][1,3]benzoxazole?
The IUPAC name of 1,2-dihydrobenzo[e][1,3]benzoxazole (CID 67826426) is 1,2-dihydrobenzo[e][1,3]benzoxazole.
What is the SMILES notation for 1,2-dihydrobenzo[e][1,3]benzoxazole?
The canonical SMILES for 1,2-dihydrobenzo[e][1,3]benzoxazole is c1ccc2c3c(ccc2c1)OCN3.
What is the InChIKey of 1,2-dihydrobenzo[e][1,3]benzoxazole?
The InChIKey is JIKBWQQDHWHMBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO/c1-2-4-9-8(3-1)5-6-10-11(9)12-7-13-10/h1-6,12H,7H2.
What are the key properties of 1,2-dihydrobenzo[e][1,3]benzoxazole?
1,2-dihydrobenzo[e][1,3]benzoxazole has a molecular weight of 171.20 g/mol, XLogP of 2.60, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydrobenzo[e][1,3]benzoxazole is sourced from PubChem (CID 67826426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).