About (1-methylpiperidin-2-yl) N-(2-methyl-1-nitrooxypropan-2-yl)carbamate
(1-methylpiperidin-2-yl) N-(2-methyl-1-nitrooxypropan-2-yl)carbamate (PubChem CID 67826811) has the molecular formula C11H21N3O5
and a molecular weight of 275.31 g/mol. Its IUPAC name is (1-methylpiperidin-2-yl) N-(2-methyl-1-nitrooxypropan-2-yl)carbamate.
Molecular Properties
| Compound Name | (1-methylpiperidin-2-yl) N-(2-methyl-1-nitrooxypropan-2-yl)carbamate |
| PubChem CID | 67826811 |
| Molecular Formula | C11H21N3O5 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (1-methylpiperidin-2-yl) N-(2-methyl-1-nitrooxypropan-2-yl)carbamate |
| SMILES | CN1CCCCC1OC(=O)NC(C)(C)CO[N+](=O)[O-] |
| InChI | InChI=1S/C11H21N3O5/c1-11(2,8-18-14(16)17)12-10(15)19-9-6-4-5-7-13(9)3/h9H,4-8H2,1-3H3,(H,12,15) |
| InChIKey | CCKWBIVXJBXNTA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1-methylpiperidin-2-yl) N-(2-methyl-1-nitrooxypropan-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-2-yl) N-(2-methyl-1-nitrooxypropan-2-yl)carbamate?
The IUPAC name of (1-methylpiperidin-2-yl) N-(2-methyl-1-nitrooxypropan-2-yl)carbamate (CID 67826811) is (1-methylpiperidin-2-yl) N-(2-methyl-1-nitrooxypropan-2-yl)carbamate.
What is the SMILES notation for (1-methylpiperidin-2-yl) N-(2-methyl-1-nitrooxypropan-2-yl)carbamate?
The canonical SMILES for (1-methylpiperidin-2-yl) N-(2-methyl-1-nitrooxypropan-2-yl)carbamate is CN1CCCCC1OC(=O)NC(C)(C)CO[N+](=O)[O-].
What is the InChIKey of (1-methylpiperidin-2-yl) N-(2-methyl-1-nitrooxypropan-2-yl)carbamate?
The InChIKey is CCKWBIVXJBXNTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O5/c1-11(2,8-18-14(16)17)12-10(15)19-9-6-4-5-7-13(9)3/h9H,4-8H2,1-3H3,(H,12,15).
What are the key properties of (1-methylpiperidin-2-yl) N-(2-methyl-1-nitrooxypropan-2-yl)carbamate?
(1-methylpiperidin-2-yl) N-(2-methyl-1-nitrooxypropan-2-yl)carbamate has a molecular weight of 275.31 g/mol, XLogP of 1.14, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-2-yl) N-(2-methyl-1-nitrooxypropan-2-yl)carbamate is sourced from PubChem (CID 67826811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).