C18H23NO2 — CID 67826835
1-(cyclopentylamino)-1-naphthalen-1-yloxypropan-2-ol (PubChem CID 67826835) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-(cyclopentylamino)-1-naphthalen-1-yloxypropan-2-ol.
| Compound Name | 1-(cyclopentylamino)-1-naphthalen-1-yloxypropan-2-ol |
|---|---|
| PubChem CID | 67826835 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 1-(cyclopentylamino)-1-naphthalen-1-yloxypropan-2-ol |
| SMILES | CC(O)C(NC1CCCC1)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C18H23NO2/c1-13(20)18(19-15-9-3-4-10-15)21-17-12-6-8-14-7-2-5-11-16(14)17/h2,5-8,11-13,15,18-20H,3-4,9-10H2,1H3 |
| InChIKey | SFBZBHLDSRAHEJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|