C14H19NO6S — CID 67827099
7-methoxy-8-methylsulfinyl-2,3,4,5-tetrahydro-1H-1-benzazepine;oxalic acid (PubChem CID 67827099) has the molecular formula C14H19NO6S and a molecular weight of 329.37 g/mol. Its IUPAC name is 7-methoxy-8-methylsulfinyl-2,3,4,5-tetrahydro-1H-1-benzazepine;oxalic acid.
| Compound Name | 7-methoxy-8-methylsulfinyl-2,3,4,5-tetrahydro-1H-1-benzazepine;oxalic acid |
|---|---|
| PubChem CID | 67827099 |
| Molecular Formula | C14H19NO6S |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 7-methoxy-8-methylsulfinyl-2,3,4,5-tetrahydro-1H-1-benzazepine;oxalic acid |
| SMILES | COc1cc2c(cc1S(C)=O)NCCCC2.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H17NO2S.C2H2O4/c1-15-11-7-9-5-3-4-6-13-10(9)8-12(11)16(2)14;3-1(4)2(5)6/h7-8,13H,3-6H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | NCEAVILOSZFVPM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|