C29H48O2 — CID 67827150
(1R,3aR,9aS,11aR)-3a,6,6,9a,11a-pentamethyl-1-[(2R)-6-methylhept-5-en-2-yl]-1,2,4,5,5a,7,8,9,10,11-decahydronaphtho[1,2-g][1]benzofuran-7-ol (PubChem CID 67827150) has the molecular formula C29H48O2 and a molecular weight of 428.70 g/mol. Its IUPAC name is (1R,3aR,9aS,11aR)-3a,6,6,9a,11a-pentamethyl-1-[(2R)-6-methylhept-5-en-2-yl]-1,2,4,5,5a,7,8,9,10,11-decahydronaphtho[1,2-g][1]benzofuran-7-ol.
| Compound Name | (1R,3aR,9aS,11aR)-3a,6,6,9a,11a-pentamethyl-1-[(2R)-6-methylhept-5-en-2-yl]-1,2,4,5,5a,7,8,9,10,11-decahydronaphtho[1,2-g][1]benzofuran-7-ol |
|---|---|
| PubChem CID | 67827150 |
| Molecular Formula | C29H48O2 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.37 |
| IUPAC Name | (1R,3aR,9aS,11aR)-3a,6,6,9a,11a-pentamethyl-1-[(2R)-6-methylhept-5-en-2-yl]-1,2,4,5,5a,7,8,9,10,11-decahydronaphtho[1,2-g][1]benzofuran-7-ol |
| SMILES | CC(C)=CCC[C@@H](C)[C@H]1CO[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CCC(O)C(C)(C)C1CC3 |
| InChI | InChI=1S/C29H48O2/c1-19(2)10-9-11-20(3)23-18-31-29(8)22-12-13-24-26(4,5)25(30)15-16-27(24,6)21(22)14-17-28(23,29)7/h10,20,23-25,30H,9,11-18H2,1-8H3/t20-,23-,24?,25?,27-,28-,29+/m1/s1 |
| InChIKey | SXSQSHAOCVLFNU-JJSZINNCSA-N |
| XLogP | 7.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|