C30H39N4O8+ — CID 67827432
bis((E)-but-2-enedioic acid);1-ethyl-N-(6-phenyl-5-propylpyridazin-3-yl)-1-azoniabicyclo[3.2.1]octan-2-amine (PubChem CID 67827432) has the molecular formula C30H39N4O8+ and a molecular weight of 583.66 g/mol. Its IUPAC name is bis((E)-but-2-enedioic acid);1-ethyl-N-(6-phenyl-5-propylpyridazin-3-yl)-1-azoniabicyclo[3.2.1]octan-2-amine.
| Compound Name | bis((E)-but-2-enedioic acid);1-ethyl-N-(6-phenyl-5-propylpyridazin-3-yl)-1-azoniabicyclo[3.2.1]octan-2-amine |
|---|---|
| PubChem CID | 67827432 |
| Molecular Formula | C30H39N4O8+ |
| Molecular Weight | 583.66 g/mol |
| Exact Mass | 583.28 |
| IUPAC Name | bis((E)-but-2-enedioic acid);1-ethyl-N-(6-phenyl-5-propylpyridazin-3-yl)-1-azoniabicyclo[3.2.1]octan-2-amine |
| SMILES | CCCc1cc(NC2CCC3CC[N+]2(CC)C3)nnc1-c1ccccc1.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C22H31N4.2C4H4O4/c1-3-8-19-15-20(24-25-22(19)18-9-6-5-7-10-18)23-21-12-11-17-13-14-26(21,4-2)16-17;2*5-3(6)1-2-4(7)8/h5-7,9-10,15,17,21H,3-4,8,11-14,16H2,1-2H3,(H,23,24);2*1-2H,(H,5,6)(H,7,8)/q+1;;/b;2*2-1+ |
| InChIKey | FHDIQMNJAHMPHG-LVEZLNDCSA-N |
| XLogP | 3.91 |
| TPSA | 187.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.66 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|