C15H26N2O3 — CID 67827634
1-cyclohexyl-5-ethyl-1,3-diazinane-2,4,6-trione;propane (PubChem CID 67827634) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is 1-cyclohexyl-5-ethyl-1,3-diazinane-2,4,6-trione;propane.
| Compound Name | 1-cyclohexyl-5-ethyl-1,3-diazinane-2,4,6-trione;propane |
|---|---|
| PubChem CID | 67827634 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 1-cyclohexyl-5-ethyl-1,3-diazinane-2,4,6-trione;propane |
| SMILES | CCC.CCC1C(=O)NC(=O)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C12H18N2O3.C3H8/c1-2-9-10(15)13-12(17)14(11(9)16)8-6-4-3-5-7-8;1-3-2/h8-9H,2-7H2,1H3,(H,13,15,17);3H2,1-2H3 |
| InChIKey | OFPXCGDUZQLNRT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|