C17H20O6 — CID 67827688
(2S,3R,4S,5R,6R)-6-(hydroxymethyl)-2-methoxy-2-naphthalen-1-yloxane-3,4,5-triol (PubChem CID 67827688) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-6-(hydroxymethyl)-2-methoxy-2-naphthalen-1-yloxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R,6R)-6-(hydroxymethyl)-2-methoxy-2-naphthalen-1-yloxane-3,4,5-triol |
|---|---|
| PubChem CID | 67827688 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | (2S,3R,4S,5R,6R)-6-(hydroxymethyl)-2-methoxy-2-naphthalen-1-yloxane-3,4,5-triol |
| SMILES | CO[C@@]1(c2cccc3ccccc23)O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C17H20O6/c1-22-17(16(21)15(20)14(19)13(9-18)23-17)12-8-4-6-10-5-2-3-7-11(10)12/h2-8,13-16,18-21H,9H2,1H3/t13-,14+,15+,16-,17+/m1/s1 |
| InChIKey | IHNNCXQYBATKCB-HMDCTGQHSA-N |
| XLogP | 0.11 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |