C23H39NO4 — CID 67827691
7-[(8aR)-8-hydroxy-1,6-dimethyl-6,7,8,8a-tetrahydro-2H-naphthalen-1-yl]-N-butyl-3,5-dihydroxyheptanamide (PubChem CID 67827691) has the molecular formula C23H39NO4 and a molecular weight of 393.57 g/mol. Its IUPAC name is 7-[(8aR)-8-hydroxy-1,6-dimethyl-6,7,8,8a-tetrahydro-2H-naphthalen-1-yl]-N-butyl-3,5-dihydroxyheptanamide.
| Compound Name | 7-[(8aR)-8-hydroxy-1,6-dimethyl-6,7,8,8a-tetrahydro-2H-naphthalen-1-yl]-N-butyl-3,5-dihydroxyheptanamide |
|---|---|
| PubChem CID | 67827691 |
| Molecular Formula | C23H39NO4 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.29 |
| IUPAC Name | 7-[(8aR)-8-hydroxy-1,6-dimethyl-6,7,8,8a-tetrahydro-2H-naphthalen-1-yl]-N-butyl-3,5-dihydroxyheptanamide |
| SMILES | CCCCNC(=O)CC(O)CC(O)CCC1(C)CC=CC2=CC(C)CC(O)[C@@H]21 |
| InChI | InChI=1S/C23H39NO4/c1-4-5-11-24-21(28)15-19(26)14-18(25)8-10-23(3)9-6-7-17-12-16(2)13-20(27)22(17)23/h6-7,12,16,18-20,22,25-27H,4-5,8-11,13-15H2,1-3H3,(H,24,28)/t16?,18?,19?,20?,22-,23?/m1/s1 |
| InChIKey | JMRGFILATOCAOM-FIZSFYLHSA-N |
| XLogP | 3.09 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|