About methyl 1-amino-2,2-bis(2-aminopropanoyl)cyclobutane-1-carboxylate
methyl 1-amino-2,2-bis(2-aminopropanoyl)cyclobutane-1-carboxylate (PubChem CID 67827972) has the molecular formula C12H21N3O4
and a molecular weight of 271.32 g/mol. Its IUPAC name is methyl 1-amino-2,2-bis(2-aminopropanoyl)cyclobutane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1-amino-2,2-bis(2-aminopropanoyl)cyclobutane-1-carboxylate |
| PubChem CID | 67827972 |
| Molecular Formula | C12H21N3O4 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | methyl 1-amino-2,2-bis(2-aminopropanoyl)cyclobutane-1-carboxylate |
| SMILES | COC(=O)C1(N)CCC1(C(=O)C(C)N)C(=O)C(C)N |
| InChI | InChI=1S/C12H21N3O4/c1-6(13)8(16)11(9(17)7(2)14)4-5-12(11,15)10(18)19-3/h6-7H,4-5,13-15H2,1-3H3 |
| InChIKey | QZUAIHRVFNBPQH-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 138.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-amino-2,2-bis(2-aminopropanoyl)cyclobutane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-amino-2,2-bis(2-aminopropanoyl)cyclobutane-1-carboxylate?
The IUPAC name of methyl 1-amino-2,2-bis(2-aminopropanoyl)cyclobutane-1-carboxylate (CID 67827972) is methyl 1-amino-2,2-bis(2-aminopropanoyl)cyclobutane-1-carboxylate.
What is the SMILES notation for methyl 1-amino-2,2-bis(2-aminopropanoyl)cyclobutane-1-carboxylate?
The canonical SMILES for methyl 1-amino-2,2-bis(2-aminopropanoyl)cyclobutane-1-carboxylate is COC(=O)C1(N)CCC1(C(=O)C(C)N)C(=O)C(C)N.
What is the InChIKey of methyl 1-amino-2,2-bis(2-aminopropanoyl)cyclobutane-1-carboxylate?
The InChIKey is QZUAIHRVFNBPQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O4/c1-6(13)8(16)11(9(17)7(2)14)4-5-12(11,15)10(18)19-3/h6-7H,4-5,13-15H2,1-3H3.
What are the key properties of methyl 1-amino-2,2-bis(2-aminopropanoyl)cyclobutane-1-carboxylate?
methyl 1-amino-2,2-bis(2-aminopropanoyl)cyclobutane-1-carboxylate has a molecular weight of 271.32 g/mol, XLogP of -1.53, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-amino-2,2-bis(2-aminopropanoyl)cyclobutane-1-carboxylate is sourced from PubChem (CID 67827972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).