C23H25NO2S — CID 67828103
2-ethyl-6-[2-(2,2,4,4-tetramethyl-3H-thiochromen-7-yl)ethynyl]pyridine-3-carboxylic acid (PubChem CID 67828103) has the molecular formula C23H25NO2S and a molecular weight of 379.53 g/mol. Its IUPAC name is 2-ethyl-6-[2-(2,2,4,4-tetramethyl-3H-thiochromen-7-yl)ethynyl]pyridine-3-carboxylic acid.
| Compound Name | 2-ethyl-6-[2-(2,2,4,4-tetramethyl-3H-thiochromen-7-yl)ethynyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 67828103 |
| Molecular Formula | C23H25NO2S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 2-ethyl-6-[2-(2,2,4,4-tetramethyl-3H-thiochromen-7-yl)ethynyl]pyridine-3-carboxylic acid |
| SMILES | CCc1nc(C#Cc2ccc3c(c2)SC(C)(C)CC3(C)C)ccc1C(=O)O |
| InChI | InChI=1S/C23H25NO2S/c1-6-19-17(21(25)26)11-10-16(24-19)9-7-15-8-12-18-20(13-15)27-23(4,5)14-22(18,2)3/h8,10-13H,6,14H2,1-5H3,(H,25,26) |
| InChIKey | HTEYHKMWTUMQOW-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|