About 4-(2-cyclohexyl-1,3-dioxolan-2-yl)-2-phenylbutanenitrile;N-methylmethanamine
4-(2-cyclohexyl-1,3-dioxolan-2-yl)-2-phenylbutanenitrile;N-methylmethanamine (PubChem CID 67828273) has the molecular formula C21H32N2O2
and a molecular weight of 344.50 g/mol. Its IUPAC name is 4-(2-cyclohexyl-1,3-dioxolan-2-yl)-2-phenylbutanenitrile;N-methylmethanamine.
Molecular Properties
| Compound Name | 4-(2-cyclohexyl-1,3-dioxolan-2-yl)-2-phenylbutanenitrile;N-methylmethanamine |
| PubChem CID | 67828273 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | 4-(2-cyclohexyl-1,3-dioxolan-2-yl)-2-phenylbutanenitrile;N-methylmethanamine |
| SMILES | CNC.N#CC(CCC1(C2CCCCC2)OCCO1)c1ccccc1 |
| InChI | InChI=1S/C19H25NO2.C2H7N/c20-15-17(16-7-3-1-4-8-16)11-12-19(21-13-14-22-19)18-9-5-2-6-10-18;1-3-2/h1,3-4,7-8,17-18H,2,5-6,9-14H2;3H,1-2H3 |
| InChIKey | ZWUQOBYCRDVILQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-cyclohexyl-1,3-dioxolan-2-yl)-2-phenylbutanenitrile;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-cyclohexyl-1,3-dioxolan-2-yl)-2-phenylbutanenitrile;N-methylmethanamine?
The IUPAC name of 4-(2-cyclohexyl-1,3-dioxolan-2-yl)-2-phenylbutanenitrile;N-methylmethanamine (CID 67828273) is 4-(2-cyclohexyl-1,3-dioxolan-2-yl)-2-phenylbutanenitrile;N-methylmethanamine.
What is the SMILES notation for 4-(2-cyclohexyl-1,3-dioxolan-2-yl)-2-phenylbutanenitrile;N-methylmethanamine?
The canonical SMILES for 4-(2-cyclohexyl-1,3-dioxolan-2-yl)-2-phenylbutanenitrile;N-methylmethanamine is CNC.N#CC(CCC1(C2CCCCC2)OCCO1)c1ccccc1.
What is the InChIKey of 4-(2-cyclohexyl-1,3-dioxolan-2-yl)-2-phenylbutanenitrile;N-methylmethanamine?
The InChIKey is ZWUQOBYCRDVILQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NO2.C2H7N/c20-15-17(16-7-3-1-4-8-16)11-12-19(21-13-14-22-19)18-9-5-2-6-10-18;1-3-2/h1,3-4,7-8,17-18H,2,5-6,9-14H2;3H,1-2H3.
What are the key properties of 4-(2-cyclohexyl-1,3-dioxolan-2-yl)-2-phenylbutanenitrile;N-methylmethanamine?
4-(2-cyclohexyl-1,3-dioxolan-2-yl)-2-phenylbutanenitrile;N-methylmethanamine has a molecular weight of 344.50 g/mol, XLogP of 4.23, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-cyclohexyl-1,3-dioxolan-2-yl)-2-phenylbutanenitrile;N-methylmethanamine is sourced from PubChem (CID 67828273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).