About (3-amino-4,4-dihydroxycyclohexa-1,5-dien-1-yl)-(3-aminophenyl)methanone
(3-amino-4,4-dihydroxycyclohexa-1,5-dien-1-yl)-(3-aminophenyl)methanone (PubChem CID 67828375) has the molecular formula C13H14N2O3
and a molecular weight of 246.27 g/mol. Its IUPAC name is (3-amino-4,4-dihydroxycyclohexa-1,5-dien-1-yl)-(3-aminophenyl)methanone.
Molecular Properties
| Compound Name | (3-amino-4,4-dihydroxycyclohexa-1,5-dien-1-yl)-(3-aminophenyl)methanone |
| PubChem CID | 67828375 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | (3-amino-4,4-dihydroxycyclohexa-1,5-dien-1-yl)-(3-aminophenyl)methanone |
| SMILES | Nc1cccc(C(=O)C2=CC(N)C(O)(O)C=C2)c1 |
| InChI | InChI=1S/C13H14N2O3/c14-10-3-1-2-8(6-10)12(16)9-4-5-13(17,18)11(15)7-9/h1-7,11,17-18H,14-15H2 |
| InChIKey | WLPVRBCROFFWCM-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (3-amino-4,4-dihydroxycyclohexa-1,5-dien-1-yl)-(3-aminophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-4,4-dihydroxycyclohexa-1,5-dien-1-yl)-(3-aminophenyl)methanone?
The IUPAC name of (3-amino-4,4-dihydroxycyclohexa-1,5-dien-1-yl)-(3-aminophenyl)methanone (CID 67828375) is (3-amino-4,4-dihydroxycyclohexa-1,5-dien-1-yl)-(3-aminophenyl)methanone.
What is the SMILES notation for (3-amino-4,4-dihydroxycyclohexa-1,5-dien-1-yl)-(3-aminophenyl)methanone?
The canonical SMILES for (3-amino-4,4-dihydroxycyclohexa-1,5-dien-1-yl)-(3-aminophenyl)methanone is Nc1cccc(C(=O)C2=CC(N)C(O)(O)C=C2)c1.
What is the InChIKey of (3-amino-4,4-dihydroxycyclohexa-1,5-dien-1-yl)-(3-aminophenyl)methanone?
The InChIKey is WLPVRBCROFFWCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O3/c14-10-3-1-2-8(6-10)12(16)9-4-5-13(17,18)11(15)7-9/h1-7,11,17-18H,14-15H2.
What are the key properties of (3-amino-4,4-dihydroxycyclohexa-1,5-dien-1-yl)-(3-aminophenyl)methanone?
(3-amino-4,4-dihydroxycyclohexa-1,5-dien-1-yl)-(3-aminophenyl)methanone has a molecular weight of 246.27 g/mol, XLogP of -0.04, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-4,4-dihydroxycyclohexa-1,5-dien-1-yl)-(3-aminophenyl)methanone is sourced from PubChem (CID 67828375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).