C9H6Cl2F3NO — CID 67828425
N-[2,4-dichloro-3-(trifluoromethyl)phenyl]acetamide (PubChem CID 67828425) has the molecular formula C9H6Cl2F3NO and a molecular weight of 272.05 g/mol. Its IUPAC name is N-[2,4-dichloro-3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[2,4-dichloro-3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 67828425 |
| Molecular Formula | C9H6Cl2F3NO |
| Molecular Weight | 272.05 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | N-[2,4-dichloro-3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C9H6Cl2F3NO/c1-4(16)15-6-3-2-5(10)7(8(6)11)9(12,13)14/h2-3H,1H3,(H,15,16) |
| InChIKey | GGOHGEWWRMFRQZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.05 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |