C13H22O6 — CID 67828521
(2S,3R,4S,5R,6R)-6-(1-hydroxybut-3-enyl)-2-methoxy-3-prop-2-enyloxane-3,4,5-triol (PubChem CID 67828521) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-6-(1-hydroxybut-3-enyl)-2-methoxy-3-prop-2-enyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R,6R)-6-(1-hydroxybut-3-enyl)-2-methoxy-3-prop-2-enyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 67828521 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (2S,3R,4S,5R,6R)-6-(1-hydroxybut-3-enyl)-2-methoxy-3-prop-2-enyloxane-3,4,5-triol |
| SMILES | C=CCC(O)[C@H]1O[C@H](OC)[C@@](O)(CC=C)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H22O6/c1-4-6-8(14)10-9(15)11(16)13(17,7-5-2)12(18-3)19-10/h4-5,8-12,14-17H,1-2,6-7H2,3H3/t8?,9-,10+,11-,12-,13+/m0/s1 |
| InChIKey | PAUHIKBTYLMLQK-ZIBUBQQJSA-N |
| XLogP | -0.68 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|