About 2,5-dichloro-4-(3,5-dichloro-4-methylthiophen-2-yl)-1H-pyrrole-3-carbonitrile
2,5-dichloro-4-(3,5-dichloro-4-methylthiophen-2-yl)-1H-pyrrole-3-carbonitrile (PubChem CID 67828591) has the molecular formula C10H4Cl4N2S
and a molecular weight of 326.04 g/mol. Its IUPAC name is 2,5-dichloro-4-(3,5-dichloro-4-methylthiophen-2-yl)-1H-pyrrole-3-carbonitrile.
Molecular Properties
| Compound Name | 2,5-dichloro-4-(3,5-dichloro-4-methylthiophen-2-yl)-1H-pyrrole-3-carbonitrile |
| PubChem CID | 67828591 |
| Molecular Formula | C10H4Cl4N2S |
| Molecular Weight | 326.04 g/mol |
| Exact Mass | 323.88 |
| IUPAC Name | 2,5-dichloro-4-(3,5-dichloro-4-methylthiophen-2-yl)-1H-pyrrole-3-carbonitrile |
| SMILES | Cc1c(Cl)sc(-c2c(Cl)[nH]c(Cl)c2C#N)c1Cl |
| InChI | InChI=1S/C10H4Cl4N2S/c1-3-6(11)7(17-10(3)14)5-4(2-15)8(12)16-9(5)13/h16H,1H3 |
| InChIKey | JIBHPBLAMSUCHG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.04 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-dichloro-4-(3,5-dichloro-4-methylthiophen-2-yl)-1H-pyrrole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dichloro-4-(3,5-dichloro-4-methylthiophen-2-yl)-1H-pyrrole-3-carbonitrile?
The IUPAC name of 2,5-dichloro-4-(3,5-dichloro-4-methylthiophen-2-yl)-1H-pyrrole-3-carbonitrile (CID 67828591) is 2,5-dichloro-4-(3,5-dichloro-4-methylthiophen-2-yl)-1H-pyrrole-3-carbonitrile.
What is the SMILES notation for 2,5-dichloro-4-(3,5-dichloro-4-methylthiophen-2-yl)-1H-pyrrole-3-carbonitrile?
The canonical SMILES for 2,5-dichloro-4-(3,5-dichloro-4-methylthiophen-2-yl)-1H-pyrrole-3-carbonitrile is Cc1c(Cl)sc(-c2c(Cl)[nH]c(Cl)c2C#N)c1Cl.
What is the InChIKey of 2,5-dichloro-4-(3,5-dichloro-4-methylthiophen-2-yl)-1H-pyrrole-3-carbonitrile?
The InChIKey is JIBHPBLAMSUCHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4Cl4N2S/c1-3-6(11)7(17-10(3)14)5-4(2-15)8(12)16-9(5)13/h16H,1H3.
What are the key properties of 2,5-dichloro-4-(3,5-dichloro-4-methylthiophen-2-yl)-1H-pyrrole-3-carbonitrile?
2,5-dichloro-4-(3,5-dichloro-4-methylthiophen-2-yl)-1H-pyrrole-3-carbonitrile has a molecular weight of 326.04 g/mol, XLogP of 5.54, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichloro-4-(3,5-dichloro-4-methylthiophen-2-yl)-1H-pyrrole-3-carbonitrile is sourced from PubChem (CID 67828591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).