About CID 67829184
CID 67829184 (PubChem CID 67829184) has the molecular formula C38H48NO6SSi2
and a molecular weight of 703.04 g/mol.
Molecular Properties
| Compound Name | CID 67829184 |
| PubChem CID | 67829184 |
| Molecular Formula | C38H48NO6SSi2 |
| Molecular Weight | 703.04 g/mol |
| Exact Mass | 702.27 |
| IUPAC Name | — |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N2C(C(=O)O)=C(COc3ccc(C(C)(C)C)cc3CO[Si](c3ccccc3)c3ccccc3)S[C@H]12 |
| InChI | InChI=1S/C38H48NO6SSi2/c1-25(45-48(8,9)38(5,6)7)32-34(40)39-33(36(41)42)31(46-35(32)39)24-43-30-21-20-27(37(2,3)4)22-26(30)23-44-47(28-16-12-10-13-17-28)29-18-14-11-15-19-29/h10-22,25,32,35H,23-24H2,1-9H3,(H,41,42)/t25-,32+,35-/m1/s1 |
| InChIKey | ZEBPDZKKNGLMBE-LHWFVLIXSA-N |
| XLogP | 6.92 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 703.04 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 67829184 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67829184?
The IUPAC name of CID 67829184 (CID 67829184) is not available.
What is the SMILES notation for CID 67829184?
The canonical SMILES for CID 67829184 is C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N2C(C(=O)O)=C(COc3ccc(C(C)(C)C)cc3CO[Si](c3ccccc3)c3ccccc3)S[C@H]12.
What is the InChIKey of CID 67829184?
The InChIKey is ZEBPDZKKNGLMBE-LHWFVLIXSA-N. The full InChI is InChI=1S/C38H48NO6SSi2/c1-25(45-48(8,9)38(5,6)7)32-34(40)39-33(36(41)42)31(46-35(32)39)24-43-30-21-20-27(37(2,3)4)22-26(30)23-44-47(28-16-12-10-13-17-28)29-18-14-11-15-19-29/h10-22,25,32,35H,23-24H2,1-9H3,(H,41,42)/t25-,32+,35-/m1/s1.
What are the key properties of CID 67829184?
CID 67829184 has a molecular weight of 703.04 g/mol, XLogP of 6.92, 12 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67829184 is sourced from PubChem (CID 67829184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).