About CID 67829240
CID 67829240 (PubChem CID 67829240) has the molecular formula C25H27O4Si
and a molecular weight of 419.57 g/mol.
Molecular Properties
| Compound Name | CID 67829240 |
| PubChem CID | 67829240 |
| Molecular Formula | C25H27O4Si |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(OCC(=O)O)c(CO[Si](c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C25H27O4Si/c1-25(2,3)20-14-15-23(28-18-24(26)27)19(16-20)17-29-30(21-10-6-4-7-11-21)22-12-8-5-9-13-22/h4-16H,17-18H2,1-3H3,(H,26,27) |
| InChIKey | WLQABCHBOYKNNT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 67829240 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67829240?
The IUPAC name of CID 67829240 (CID 67829240) is not available.
What is the SMILES notation for CID 67829240?
The canonical SMILES for CID 67829240 is CC(C)(C)c1ccc(OCC(=O)O)c(CO[Si](c2ccccc2)c2ccccc2)c1.
What is the InChIKey of CID 67829240?
The InChIKey is WLQABCHBOYKNNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27O4Si/c1-25(2,3)20-14-15-23(28-18-24(26)27)19(16-20)17-29-30(21-10-6-4-7-11-21)22-12-8-5-9-13-22/h4-16H,17-18H2,1-3H3,(H,26,27).
What are the key properties of CID 67829240?
CID 67829240 has a molecular weight of 419.57 g/mol, XLogP of 3.77, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67829240 is sourced from PubChem (CID 67829240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).