About 2H-benzotriazole;1H-indazole
2H-benzotriazole;1H-indazole (PubChem CID 67829354) has the molecular formula C13H11N5
and a molecular weight of 237.27 g/mol. Its IUPAC name is 2H-benzotriazole;1H-indazole.
Molecular Properties
| Compound Name | 2H-benzotriazole;1H-indazole |
| PubChem CID | 67829354 |
| Molecular Formula | C13H11N5 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2H-benzotriazole;1H-indazole |
| SMILES | c1ccc2[nH]ncc2c1.c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C7H6N2.C6H5N3/c1-2-4-7-6(3-1)5-8-9-7;1-2-4-6-5(3-1)7-9-8-6/h1-5H,(H,8,9);1-4H,(H,7,8,9) |
| InChIKey | HJNAWGLDWOKLBZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2H-benzotriazole;1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-benzotriazole;1H-indazole?
The IUPAC name of 2H-benzotriazole;1H-indazole (CID 67829354) is 2H-benzotriazole;1H-indazole.
What is the SMILES notation for 2H-benzotriazole;1H-indazole?
The canonical SMILES for 2H-benzotriazole;1H-indazole is c1ccc2[nH]ncc2c1.c1ccc2n[nH]nc2c1.
What is the InChIKey of 2H-benzotriazole;1H-indazole?
The InChIKey is HJNAWGLDWOKLBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C6H5N3/c1-2-4-7-6(3-1)5-8-9-7;1-2-4-6-5(3-1)7-9-8-6/h1-5H,(H,8,9);1-4H,(H,7,8,9).
What are the key properties of 2H-benzotriazole;1H-indazole?
2H-benzotriazole;1H-indazole has a molecular weight of 237.27 g/mol, XLogP of 2.52, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-benzotriazole;1H-indazole is sourced from PubChem (CID 67829354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).