About 2-aminoacetic acid;oxalic acid;piperidin-4-ol
2-aminoacetic acid;oxalic acid;piperidin-4-ol (PubChem CID 67829819) has the molecular formula C9H18N2O7
and a molecular weight of 266.25 g/mol. Its IUPAC name is 2-aminoacetic acid;oxalic acid;piperidin-4-ol.
Molecular Properties
| Compound Name | 2-aminoacetic acid;oxalic acid;piperidin-4-ol |
| PubChem CID | 67829819 |
| Molecular Formula | C9H18N2O7 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 2-aminoacetic acid;oxalic acid;piperidin-4-ol |
| SMILES | NCC(=O)O.O=C(O)C(=O)O.OC1CCNCC1 |
| InChI | InChI=1S/C5H11NO.C2H5NO2.C2H2O4/c7-5-1-3-6-4-2-5;3-1-2(4)5;3-1(4)2(5)6/h5-7H,1-4H2;1,3H2,(H,4,5);(H,3,4)(H,5,6) |
| InChIKey | GJKMVILJFZRGQW-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 170.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoacetic acid;oxalic acid;piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetic acid;oxalic acid;piperidin-4-ol?
The IUPAC name of 2-aminoacetic acid;oxalic acid;piperidin-4-ol (CID 67829819) is 2-aminoacetic acid;oxalic acid;piperidin-4-ol.
What is the SMILES notation for 2-aminoacetic acid;oxalic acid;piperidin-4-ol?
The canonical SMILES for 2-aminoacetic acid;oxalic acid;piperidin-4-ol is NCC(=O)O.O=C(O)C(=O)O.OC1CCNCC1.
What is the InChIKey of 2-aminoacetic acid;oxalic acid;piperidin-4-ol?
The InChIKey is GJKMVILJFZRGQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO.C2H5NO2.C2H2O4/c7-5-1-3-6-4-2-5;3-1-2(4)5;3-1(4)2(5)6/h5-7H,1-4H2;1,3H2,(H,4,5);(H,3,4)(H,5,6).
What are the key properties of 2-aminoacetic acid;oxalic acid;piperidin-4-ol?
2-aminoacetic acid;oxalic acid;piperidin-4-ol has a molecular weight of 266.25 g/mol, XLogP of -2.08, 1 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetic acid;oxalic acid;piperidin-4-ol is sourced from PubChem (CID 67829819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).