About (Z)-2-[(2S,3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-pyridin-3-ylpyrrolidin-3-yl]hex-4-enoic acid
(Z)-2-[(2S,3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-pyridin-3-ylpyrrolidin-3-yl]hex-4-enoic acid (PubChem CID 67830071) has the molecular formula C20H28N2O4
and a molecular weight of 360.45 g/mol. Its IUPAC name is (Z)-2-[(2S,3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-pyridin-3-ylpyrrolidin-3-yl]hex-4-enoic acid.
Molecular Properties
| Compound Name | (Z)-2-[(2S,3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-pyridin-3-ylpyrrolidin-3-yl]hex-4-enoic acid |
| PubChem CID | 67830071 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | (Z)-2-[(2S,3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-pyridin-3-ylpyrrolidin-3-yl]hex-4-enoic acid |
| SMILES | C/C=C\CC(C(=O)O)[C@@H]1CCN(C(=O)OC(C)(C)C)[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C20H28N2O4/c1-5-6-9-16(18(23)24)15-10-12-22(19(25)26-20(2,3)4)17(15)14-8-7-11-21-13-14/h5-8,11,13,15-17H,9-10,12H2,1-4H3,(H,23,24)/b6-5-/t15-,16?,17+/m0/s1 |
| InChIKey | WQNSYJRJJHNBOC-ZQMASLLOSA-N |
| XLogP | 4.05 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-[(2S,3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-pyridin-3-ylpyrrolidin-3-yl]hex-4-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-[(2S,3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-pyridin-3-ylpyrrolidin-3-yl]hex-4-enoic acid?
The IUPAC name of (Z)-2-[(2S,3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-pyridin-3-ylpyrrolidin-3-yl]hex-4-enoic acid (CID 67830071) is (Z)-2-[(2S,3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-pyridin-3-ylpyrrolidin-3-yl]hex-4-enoic acid.
What is the SMILES notation for (Z)-2-[(2S,3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-pyridin-3-ylpyrrolidin-3-yl]hex-4-enoic acid?
The canonical SMILES for (Z)-2-[(2S,3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-pyridin-3-ylpyrrolidin-3-yl]hex-4-enoic acid is C/C=C\CC(C(=O)O)[C@@H]1CCN(C(=O)OC(C)(C)C)[C@@H]1c1cccnc1.
What is the InChIKey of (Z)-2-[(2S,3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-pyridin-3-ylpyrrolidin-3-yl]hex-4-enoic acid?
The InChIKey is WQNSYJRJJHNBOC-ZQMASLLOSA-N. The full InChI is InChI=1S/C20H28N2O4/c1-5-6-9-16(18(23)24)15-10-12-22(19(25)26-20(2,3)4)17(15)14-8-7-11-21-13-14/h5-8,11,13,15-17H,9-10,12H2,1-4H3,(H,23,24)/b6-5-/t15-,16?,17+/m0/s1.
What are the key properties of (Z)-2-[(2S,3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-pyridin-3-ylpyrrolidin-3-yl]hex-4-enoic acid?
(Z)-2-[(2S,3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-pyridin-3-ylpyrrolidin-3-yl]hex-4-enoic acid has a molecular weight of 360.45 g/mol, XLogP of 4.05, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-[(2S,3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-pyridin-3-ylpyrrolidin-3-yl]hex-4-enoic acid is sourced from PubChem (CID 67830071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).