About 3-(dimethylamino)propanoic acid;oxalic acid;piperidin-4-ol
3-(dimethylamino)propanoic acid;oxalic acid;piperidin-4-ol (PubChem CID 67830451) has the molecular formula C12H24N2O7
and a molecular weight of 308.33 g/mol. Its IUPAC name is 3-(dimethylamino)propanoic acid;oxalic acid;piperidin-4-ol.
Molecular Properties
| Compound Name | 3-(dimethylamino)propanoic acid;oxalic acid;piperidin-4-ol |
| PubChem CID | 67830451 |
| Molecular Formula | C12H24N2O7 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 3-(dimethylamino)propanoic acid;oxalic acid;piperidin-4-ol |
| SMILES | CN(C)CCC(=O)O.O=C(O)C(=O)O.OC1CCNCC1 |
| InChI | InChI=1S/C5H11NO2.C5H11NO.C2H2O4/c1-6(2)4-3-5(7)8;7-5-1-3-6-4-2-5;3-1(4)2(5)6/h3-4H2,1-2H3,(H,7,8);5-7H,1-4H2;(H,3,4)(H,5,6) |
| InChIKey | ZXKZDOCWSQOKNM-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 147.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)propanoic acid;oxalic acid;piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)propanoic acid;oxalic acid;piperidin-4-ol?
The IUPAC name of 3-(dimethylamino)propanoic acid;oxalic acid;piperidin-4-ol (CID 67830451) is 3-(dimethylamino)propanoic acid;oxalic acid;piperidin-4-ol.
What is the SMILES notation for 3-(dimethylamino)propanoic acid;oxalic acid;piperidin-4-ol?
The canonical SMILES for 3-(dimethylamino)propanoic acid;oxalic acid;piperidin-4-ol is CN(C)CCC(=O)O.O=C(O)C(=O)O.OC1CCNCC1.
What is the InChIKey of 3-(dimethylamino)propanoic acid;oxalic acid;piperidin-4-ol?
The InChIKey is ZXKZDOCWSQOKNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2.C5H11NO.C2H2O4/c1-6(2)4-3-5(7)8;7-5-1-3-6-4-2-5;3-1(4)2(5)6/h3-4H2,1-2H3,(H,7,8);5-7H,1-4H2;(H,3,4)(H,5,6).
What are the key properties of 3-(dimethylamino)propanoic acid;oxalic acid;piperidin-4-ol?
3-(dimethylamino)propanoic acid;oxalic acid;piperidin-4-ol has a molecular weight of 308.33 g/mol, XLogP of -1.09, 3 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)propanoic acid;oxalic acid;piperidin-4-ol is sourced from PubChem (CID 67830451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).