About 2-(dimethylamino)acetic acid;oxalic acid;piperidin-4-ol
2-(dimethylamino)acetic acid;oxalic acid;piperidin-4-ol (PubChem CID 67830460) has the molecular formula C11H22N2O7
and a molecular weight of 294.30 g/mol. Its IUPAC name is 2-(dimethylamino)acetic acid;oxalic acid;piperidin-4-ol.
Molecular Properties
| Compound Name | 2-(dimethylamino)acetic acid;oxalic acid;piperidin-4-ol |
| PubChem CID | 67830460 |
| Molecular Formula | C11H22N2O7 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 2-(dimethylamino)acetic acid;oxalic acid;piperidin-4-ol |
| SMILES | CN(C)CC(=O)O.O=C(O)C(=O)O.OC1CCNCC1 |
| InChI | InChI=1S/C5H11NO.C4H9NO2.C2H2O4/c7-5-1-3-6-4-2-5;1-5(2)3-4(6)7;3-1(4)2(5)6/h5-7H,1-4H2;3H2,1-2H3,(H,6,7);(H,3,4)(H,5,6) |
| InChIKey | XBHOPDKXXLFEMZ-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 147.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)acetic acid;oxalic acid;piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)acetic acid;oxalic acid;piperidin-4-ol?
The IUPAC name of 2-(dimethylamino)acetic acid;oxalic acid;piperidin-4-ol (CID 67830460) is 2-(dimethylamino)acetic acid;oxalic acid;piperidin-4-ol.
What is the SMILES notation for 2-(dimethylamino)acetic acid;oxalic acid;piperidin-4-ol?
The canonical SMILES for 2-(dimethylamino)acetic acid;oxalic acid;piperidin-4-ol is CN(C)CC(=O)O.O=C(O)C(=O)O.OC1CCNCC1.
What is the InChIKey of 2-(dimethylamino)acetic acid;oxalic acid;piperidin-4-ol?
The InChIKey is XBHOPDKXXLFEMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO.C4H9NO2.C2H2O4/c7-5-1-3-6-4-2-5;1-5(2)3-4(6)7;3-1(4)2(5)6/h5-7H,1-4H2;3H2,1-2H3,(H,6,7);(H,3,4)(H,5,6).
What are the key properties of 2-(dimethylamino)acetic acid;oxalic acid;piperidin-4-ol?
2-(dimethylamino)acetic acid;oxalic acid;piperidin-4-ol has a molecular weight of 294.30 g/mol, XLogP of -1.48, 2 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)acetic acid;oxalic acid;piperidin-4-ol is sourced from PubChem (CID 67830460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).