C18H19NO7S — CID 67830769
[(3S,4S,5R,6S)-4,5-diacetyloxy-6-(4-cyanophenoxy)thian-3-yl] acetate (PubChem CID 67830769) has the molecular formula C18H19NO7S and a molecular weight of 393.42 g/mol. Its IUPAC name is [(3S,4S,5R,6S)-4,5-diacetyloxy-6-(4-cyanophenoxy)thian-3-yl] acetate.
| Compound Name | [(3S,4S,5R,6S)-4,5-diacetyloxy-6-(4-cyanophenoxy)thian-3-yl] acetate |
|---|---|
| PubChem CID | 67830769 |
| Molecular Formula | C18H19NO7S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | [(3S,4S,5R,6S)-4,5-diacetyloxy-6-(4-cyanophenoxy)thian-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@@H](Oc2ccc(C#N)cc2)SC[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H19NO7S/c1-10(20)23-15-9-27-18(26-14-6-4-13(8-19)5-7-14)17(25-12(3)22)16(15)24-11(2)21/h4-7,15-18H,9H2,1-3H3/t15-,16+,17-,18+/m1/s1 |
| InChIKey | BNPJBPDESDRIFD-XDNAFOTISA-N |
| XLogP | 1.81 |
| TPSA | 111.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|