C29H36O3 — CID 67831570
(8R,9S,10R,11S,13S,14S)-13-methyl-11-(4-prop-2-enylphenyl)spiro[1,2,4,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-one (PubChem CID 67831570) has the molecular formula C29H36O3 and a molecular weight of 432.60 g/mol. Its IUPAC name is (8R,9S,10R,11S,13S,14S)-13-methyl-11-(4-prop-2-enylphenyl)spiro[1,2,4,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-one.
| Compound Name | (8R,9S,10R,11S,13S,14S)-13-methyl-11-(4-prop-2-enylphenyl)spiro[1,2,4,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-one |
|---|---|
| PubChem CID | 67831570 |
| Molecular Formula | C29H36O3 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | (8R,9S,10R,11S,13S,14S)-13-methyl-11-(4-prop-2-enylphenyl)spiro[1,2,4,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-one |
| SMILES | C=CCc1ccc([C@H]2C[C@]3(C)C(=O)CC[C@H]3[C@@H]3CC=C4CC5(CC[C@@H]4[C@H]32)OCCO5)cc1 |
| InChI | InChI=1S/C29H36O3/c1-3-4-19-5-7-20(8-6-19)24-18-28(2)25(11-12-26(28)30)23-10-9-21-17-29(31-15-16-32-29)14-13-22(21)27(23)24/h3,5-9,22-25,27H,1,4,10-18H2,2H3/t22-,23-,24+,25-,27+,28-/m0/s1 |
| InChIKey | SESBEQYDSGSFLG-HFELEXTESA-N |
| XLogP | 5.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|