About 2-(5-hydroxy-2,6-dimethyl-4-oxo-3H-pyridin-3-yl)ethyl 2,2-dimethylpropanoate
2-(5-hydroxy-2,6-dimethyl-4-oxo-3H-pyridin-3-yl)ethyl 2,2-dimethylpropanoate (PubChem CID 67831751) has the molecular formula C14H21NO4
and a molecular weight of 267.32 g/mol. Its IUPAC name is 2-(5-hydroxy-2,6-dimethyl-4-oxo-3H-pyridin-3-yl)ethyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | 2-(5-hydroxy-2,6-dimethyl-4-oxo-3H-pyridin-3-yl)ethyl 2,2-dimethylpropanoate |
| PubChem CID | 67831751 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 2-(5-hydroxy-2,6-dimethyl-4-oxo-3H-pyridin-3-yl)ethyl 2,2-dimethylpropanoate |
| SMILES | CC1=NC(C)=C(O)C(=O)C1CCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H21NO4/c1-8-10(12(17)11(16)9(2)15-8)6-7-19-13(18)14(3,4)5/h10,16H,6-7H2,1-5H3 |
| InChIKey | KQYDISKJTGSMFZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(5-hydroxy-2,6-dimethyl-4-oxo-3H-pyridin-3-yl)ethyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-hydroxy-2,6-dimethyl-4-oxo-3H-pyridin-3-yl)ethyl 2,2-dimethylpropanoate?
The IUPAC name of 2-(5-hydroxy-2,6-dimethyl-4-oxo-3H-pyridin-3-yl)ethyl 2,2-dimethylpropanoate (CID 67831751) is 2-(5-hydroxy-2,6-dimethyl-4-oxo-3H-pyridin-3-yl)ethyl 2,2-dimethylpropanoate.
What is the SMILES notation for 2-(5-hydroxy-2,6-dimethyl-4-oxo-3H-pyridin-3-yl)ethyl 2,2-dimethylpropanoate?
The canonical SMILES for 2-(5-hydroxy-2,6-dimethyl-4-oxo-3H-pyridin-3-yl)ethyl 2,2-dimethylpropanoate is CC1=NC(C)=C(O)C(=O)C1CCOC(=O)C(C)(C)C.
What is the InChIKey of 2-(5-hydroxy-2,6-dimethyl-4-oxo-3H-pyridin-3-yl)ethyl 2,2-dimethylpropanoate?
The InChIKey is KQYDISKJTGSMFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO4/c1-8-10(12(17)11(16)9(2)15-8)6-7-19-13(18)14(3,4)5/h10,16H,6-7H2,1-5H3.
What are the key properties of 2-(5-hydroxy-2,6-dimethyl-4-oxo-3H-pyridin-3-yl)ethyl 2,2-dimethylpropanoate?
2-(5-hydroxy-2,6-dimethyl-4-oxo-3H-pyridin-3-yl)ethyl 2,2-dimethylpropanoate has a molecular weight of 267.32 g/mol, XLogP of 2.42, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-hydroxy-2,6-dimethyl-4-oxo-3H-pyridin-3-yl)ethyl 2,2-dimethylpropanoate is sourced from PubChem (CID 67831751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).