About (4-propan-2-ylphenyl) (Z)-4-amino-4-oxobut-2-enoate
(4-propan-2-ylphenyl) (Z)-4-amino-4-oxobut-2-enoate (PubChem CID 67832284) has the molecular formula C13H15NO3
and a molecular weight of 233.27 g/mol. Its IUPAC name is (4-propan-2-ylphenyl) (Z)-4-amino-4-oxobut-2-enoate.
Molecular Properties
| Compound Name | (4-propan-2-ylphenyl) (Z)-4-amino-4-oxobut-2-enoate |
| PubChem CID | 67832284 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | (4-propan-2-ylphenyl) (Z)-4-amino-4-oxobut-2-enoate |
| SMILES | CC(C)c1ccc(OC(=O)/C=C\C(N)=O)cc1 |
| InChI | InChI=1S/C13H15NO3/c1-9(2)10-3-5-11(6-4-10)17-13(16)8-7-12(14)15/h3-9H,1-2H3,(H2,14,15)/b8-7- |
| InChIKey | GAUXWMYYWRTMEV-FPLPWBNLSA-N |
| XLogP | 1.76 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-propan-2-ylphenyl) (Z)-4-amino-4-oxobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-propan-2-ylphenyl) (Z)-4-amino-4-oxobut-2-enoate?
The IUPAC name of (4-propan-2-ylphenyl) (Z)-4-amino-4-oxobut-2-enoate (CID 67832284) is (4-propan-2-ylphenyl) (Z)-4-amino-4-oxobut-2-enoate.
What is the SMILES notation for (4-propan-2-ylphenyl) (Z)-4-amino-4-oxobut-2-enoate?
The canonical SMILES for (4-propan-2-ylphenyl) (Z)-4-amino-4-oxobut-2-enoate is CC(C)c1ccc(OC(=O)/C=C\C(N)=O)cc1.
What is the InChIKey of (4-propan-2-ylphenyl) (Z)-4-amino-4-oxobut-2-enoate?
The InChIKey is GAUXWMYYWRTMEV-FPLPWBNLSA-N. The full InChI is InChI=1S/C13H15NO3/c1-9(2)10-3-5-11(6-4-10)17-13(16)8-7-12(14)15/h3-9H,1-2H3,(H2,14,15)/b8-7-.
What are the key properties of (4-propan-2-ylphenyl) (Z)-4-amino-4-oxobut-2-enoate?
(4-propan-2-ylphenyl) (Z)-4-amino-4-oxobut-2-enoate has a molecular weight of 233.27 g/mol, XLogP of 1.76, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-propan-2-ylphenyl) (Z)-4-amino-4-oxobut-2-enoate is sourced from PubChem (CID 67832284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).