C24H25N3O4P+ — CID 67832339
dihydroxy(oxo)phosphanium;1-(1-trityl-1,2,4-triazol-3-yl)propan-1-ol (PubChem CID 67832339) has the molecular formula C24H25N3O4P+ and a molecular weight of 450.46 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;1-(1-trityl-1,2,4-triazol-3-yl)propan-1-ol.
| Compound Name | dihydroxy(oxo)phosphanium;1-(1-trityl-1,2,4-triazol-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 67832339 |
| Molecular Formula | C24H25N3O4P+ |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | dihydroxy(oxo)phosphanium;1-(1-trityl-1,2,4-triazol-3-yl)propan-1-ol |
| SMILES | CCC(O)c1ncn(C(c2ccccc2)(c2ccccc2)c2ccccc2)n1.O=[P+](O)O |
| InChI | InChI=1S/C24H23N3O.HO3P/c1-2-22(28)23-25-18-27(26-23)24(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21;1-4(2)3/h3-18,22,28H,2H2,1H3;(H-,1,2,3)/p+1 |
| InChIKey | WZBHSAYMABFINB-UHFFFAOYSA-O |
| XLogP | 4.19 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|