About 4-phenyl-2-propan-2-yloxy-3,4-dihydro-2H-pyran
4-phenyl-2-propan-2-yloxy-3,4-dihydro-2H-pyran (PubChem CID 67832396) has the molecular formula C14H18O2
and a molecular weight of 218.30 g/mol. Its IUPAC name is 4-phenyl-2-propan-2-yloxy-3,4-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 4-phenyl-2-propan-2-yloxy-3,4-dihydro-2H-pyran |
| PubChem CID | 67832396 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 4-phenyl-2-propan-2-yloxy-3,4-dihydro-2H-pyran |
| SMILES | CC(C)OC1CC(c2ccccc2)C=CO1 |
| InChI | InChI=1S/C14H18O2/c1-11(2)16-14-10-13(8-9-15-14)12-6-4-3-5-7-12/h3-9,11,13-14H,10H2,1-2H3 |
| InChIKey | QBIDYABOCZWWPZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-phenyl-2-propan-2-yloxy-3,4-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-2-propan-2-yloxy-3,4-dihydro-2H-pyran?
The IUPAC name of 4-phenyl-2-propan-2-yloxy-3,4-dihydro-2H-pyran (CID 67832396) is 4-phenyl-2-propan-2-yloxy-3,4-dihydro-2H-pyran.
What is the SMILES notation for 4-phenyl-2-propan-2-yloxy-3,4-dihydro-2H-pyran?
The canonical SMILES for 4-phenyl-2-propan-2-yloxy-3,4-dihydro-2H-pyran is CC(C)OC1CC(c2ccccc2)C=CO1.
What is the InChIKey of 4-phenyl-2-propan-2-yloxy-3,4-dihydro-2H-pyran?
The InChIKey is QBIDYABOCZWWPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O2/c1-11(2)16-14-10-13(8-9-15-14)12-6-4-3-5-7-12/h3-9,11,13-14H,10H2,1-2H3.
What are the key properties of 4-phenyl-2-propan-2-yloxy-3,4-dihydro-2H-pyran?
4-phenyl-2-propan-2-yloxy-3,4-dihydro-2H-pyran has a molecular weight of 218.30 g/mol, XLogP of 3.46, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-2-propan-2-yloxy-3,4-dihydro-2H-pyran is sourced from PubChem (CID 67832396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).