(E)-2-cyano-3-(furan-3-yl)prop-2-enoic acid

C8H5NO3 — CID 67832415

IUPAC(E)-2-cyano-3-(furan-3-yl)prop-2-enoic acid
SMILESN#C/C(=C\c1ccoc1)C(=O)O
InChIInChI=1S/C8H5NO3/c9-4-7(8(10)11)3-6-1-2-12-5-6/h1-3,5H,(H,10,11)/b7-3+
InChIKeyQSMBMDUBGAVDIF-XVNBXDOJSA-N
MW163.13 g/mol
LogP1.27
Rot. Bonds2

About (E)-2-cyano-3-(furan-3-yl)prop-2-enoic acid

(E)-2-cyano-3-(furan-3-yl)prop-2-enoic acid (PubChem CID 67832415) has the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. Its IUPAC name is (E)-2-cyano-3-(furan-3-yl)prop-2-enoic acid.

Molecular Properties

Compound Name(E)-2-cyano-3-(furan-3-yl)prop-2-enoic acid
PubChem CID67832415
Molecular FormulaC8H5NO3
Molecular Weight163.13 g/mol
Exact Mass163.03
IUPAC Name(E)-2-cyano-3-(furan-3-yl)prop-2-enoic acid
SMILESN#C/C(=C\c1ccoc1)C(=O)O
InChIInChI=1S/C8H5NO3/c9-4-7(8(10)11)3-6-1-2-12-5-6/h1-3,5H,(H,10,11)/b7-3+
InChIKeyQSMBMDUBGAVDIF-XVNBXDOJSA-N
XLogP1.27
TPSA74.23 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500163.13
LogP ≤ 51.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-2-cyano-3-(furan-3-yl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-2-cyano-3-(furan-3-yl)prop-2-enoic acid?
The IUPAC name of (E)-2-cyano-3-(furan-3-yl)prop-2-enoic acid (CID 67832415) is (E)-2-cyano-3-(furan-3-yl)prop-2-enoic acid.
What is the SMILES notation for (E)-2-cyano-3-(furan-3-yl)prop-2-enoic acid?
The canonical SMILES for (E)-2-cyano-3-(furan-3-yl)prop-2-enoic acid is N#C/C(=C\c1ccoc1)C(=O)O.
What is the InChIKey of (E)-2-cyano-3-(furan-3-yl)prop-2-enoic acid?
The InChIKey is QSMBMDUBGAVDIF-XVNBXDOJSA-N. The full InChI is InChI=1S/C8H5NO3/c9-4-7(8(10)11)3-6-1-2-12-5-6/h1-3,5H,(H,10,11)/b7-3+.
What are the key properties of (E)-2-cyano-3-(furan-3-yl)prop-2-enoic acid?
(E)-2-cyano-3-(furan-3-yl)prop-2-enoic acid has a molecular weight of 163.13 g/mol, XLogP of 1.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-cyano-3-(furan-3-yl)prop-2-enoic acid is sourced from PubChem (CID 67832415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).