C31H41NO2 — CID 67832474
(1S,2S,4S,7S,9R)-6-butoxy-9-[4-(dimethylamino)phenyl]-7-methylpentacyclo[8.8.0.02,7.04,6.011,16]octadeca-10,15-dien-14-one (PubChem CID 67832474) has the molecular formula C31H41NO2 and a molecular weight of 459.67 g/mol. Its IUPAC name is (1S,2S,4S,7S,9R)-6-butoxy-9-[4-(dimethylamino)phenyl]-7-methylpentacyclo[8.8.0.02,7.04,6.011,16]octadeca-10,15-dien-14-one.
| Compound Name | (1S,2S,4S,7S,9R)-6-butoxy-9-[4-(dimethylamino)phenyl]-7-methylpentacyclo[8.8.0.02,7.04,6.011,16]octadeca-10,15-dien-14-one |
|---|---|
| PubChem CID | 67832474 |
| Molecular Formula | C31H41NO2 |
| Molecular Weight | 459.67 g/mol |
| Exact Mass | 459.31 |
| IUPAC Name | (1S,2S,4S,7S,9R)-6-butoxy-9-[4-(dimethylamino)phenyl]-7-methylpentacyclo[8.8.0.02,7.04,6.011,16]octadeca-10,15-dien-14-one |
| SMILES | CCCCOC12CC1C[C@H]1[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(N(C)C)cc3)C[C@@]12C |
| InChI | InChI=1S/C31H41NO2/c1-5-6-15-34-31-18-22(31)17-28-26-13-9-21-16-24(33)12-14-25(21)29(26)27(19-30(28,31)2)20-7-10-23(11-8-20)32(3)4/h7-8,10-11,16,22,26-28H,5-6,9,12-15,17-19H2,1-4H3/t22?,26-,27+,28-,30-,31?/m0/s1 |
| InChIKey | BCBKXCMDFNBSAU-PZBCJWJRSA-N |
| XLogP | 6.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.67 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|