C32H44O3Si — CID 67832484
(1S,2S,4S,6S,7S,9R)-6-[tert-butyl(dimethyl)silyl]oxy-9-(4-methoxyphenyl)-7-methylpentacyclo[8.8.0.02,7.04,6.011,16]octadeca-10,15-dien-14-one (PubChem CID 67832484) has the molecular formula C32H44O3Si and a molecular weight of 504.79 g/mol. Its IUPAC name is (1S,2S,4S,6S,7S,9R)-6-[tert-butyl(dimethyl)silyl]oxy-9-(4-methoxyphenyl)-7-methylpentacyclo[8.8.0.02,7.04,6.011,16]octadeca-10,15-dien-14-one.
| Compound Name | (1S,2S,4S,6S,7S,9R)-6-[tert-butyl(dimethyl)silyl]oxy-9-(4-methoxyphenyl)-7-methylpentacyclo[8.8.0.02,7.04,6.011,16]octadeca-10,15-dien-14-one |
|---|---|
| PubChem CID | 67832484 |
| Molecular Formula | C32H44O3Si |
| Molecular Weight | 504.79 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | (1S,2S,4S,6S,7S,9R)-6-[tert-butyl(dimethyl)silyl]oxy-9-(4-methoxyphenyl)-7-methylpentacyclo[8.8.0.02,7.04,6.011,16]octadeca-10,15-dien-14-one |
| SMILES | COc1ccc([C@H]2C[C@@]3(C)[C@@H](C[C@H]4C[C@]43O[Si](C)(C)C(C)(C)C)[C@@H]3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C32H44O3Si/c1-30(2,3)36(6,7)35-32-18-22(32)17-28-26-14-10-21-16-23(33)11-15-25(21)29(26)27(19-31(28,32)4)20-8-12-24(34-5)13-9-20/h8-9,12-13,16,22,26-28H,10-11,14-15,17-19H2,1-7H3/t22-,26-,27+,28-,31-,32-/m0/s1 |
| InChIKey | QCYYWKBMEAZIKA-GRDOFUHGSA-N |
| XLogP | 7.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.79 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|