About (2S)-2-amino-3-methylbutanoic acid;1-(1,2,4-triazol-1-yl)ethanone
(2S)-2-amino-3-methylbutanoic acid;1-(1,2,4-triazol-1-yl)ethanone (PubChem CID 67832895) has the molecular formula C9H16N4O3
and a molecular weight of 228.25 g/mol. Its IUPAC name is (2S)-2-amino-3-methylbutanoic acid;1-(1,2,4-triazol-1-yl)ethanone.
Molecular Properties
| Compound Name | (2S)-2-amino-3-methylbutanoic acid;1-(1,2,4-triazol-1-yl)ethanone |
| PubChem CID | 67832895 |
| Molecular Formula | C9H16N4O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | (2S)-2-amino-3-methylbutanoic acid;1-(1,2,4-triazol-1-yl)ethanone |
| SMILES | CC(=O)n1cncn1.CC(C)[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H11NO2.C4H5N3O/c1-3(2)4(6)5(7)8;1-4(8)7-3-5-2-6-7/h3-4H,6H2,1-2H3,(H,7,8);2-3H,1H3/t4-;/m0./s1 |
| InChIKey | NMMMPINRPGSDPM-WCCKRBBISA-N |
| XLogP | -0.01 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2S)-2-amino-3-methylbutanoic acid;1-(1,2,4-triazol-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3-methylbutanoic acid;1-(1,2,4-triazol-1-yl)ethanone?
The IUPAC name of (2S)-2-amino-3-methylbutanoic acid;1-(1,2,4-triazol-1-yl)ethanone (CID 67832895) is (2S)-2-amino-3-methylbutanoic acid;1-(1,2,4-triazol-1-yl)ethanone.
What is the SMILES notation for (2S)-2-amino-3-methylbutanoic acid;1-(1,2,4-triazol-1-yl)ethanone?
The canonical SMILES for (2S)-2-amino-3-methylbutanoic acid;1-(1,2,4-triazol-1-yl)ethanone is CC(=O)n1cncn1.CC(C)[C@H](N)C(=O)O.
What is the InChIKey of (2S)-2-amino-3-methylbutanoic acid;1-(1,2,4-triazol-1-yl)ethanone?
The InChIKey is NMMMPINRPGSDPM-WCCKRBBISA-N. The full InChI is InChI=1S/C5H11NO2.C4H5N3O/c1-3(2)4(6)5(7)8;1-4(8)7-3-5-2-6-7/h3-4H,6H2,1-2H3,(H,7,8);2-3H,1H3/t4-;/m0./s1.
What are the key properties of (2S)-2-amino-3-methylbutanoic acid;1-(1,2,4-triazol-1-yl)ethanone?
(2S)-2-amino-3-methylbutanoic acid;1-(1,2,4-triazol-1-yl)ethanone has a molecular weight of 228.25 g/mol, XLogP of -0.01, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-methylbutanoic acid;1-(1,2,4-triazol-1-yl)ethanone is sourced from PubChem (CID 67832895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).