C12H13N3O2 — CID 67832996
5-[(4-phenyl-1,3-dioxolan-4-yl)methyl]-1H-1,2,4-triazole (PubChem CID 67832996) has the molecular formula C12H13N3O2 and a molecular weight of 231.26 g/mol. Its IUPAC name is 5-[(4-phenyl-1,3-dioxolan-4-yl)methyl]-1H-1,2,4-triazole.
| Compound Name | 5-[(4-phenyl-1,3-dioxolan-4-yl)methyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 67832996 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 5-[(4-phenyl-1,3-dioxolan-4-yl)methyl]-1H-1,2,4-triazole |
| SMILES | c1ccc(C2(Cc3ncn[nH]3)COCO2)cc1 |
| InChI | InChI=1S/C12H13N3O2/c1-2-4-10(5-3-1)12(7-16-9-17-12)6-11-13-8-14-15-11/h1-5,8H,6-7,9H2,(H,13,14,15) |
| InChIKey | HEBPCSQYFXSIES-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |