About 6-[3-(4-bromophenyl)prop-2-enoyl]-3,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile
6-[3-(4-bromophenyl)prop-2-enoyl]-3,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile (PubChem CID 67833194) has the molecular formula C16H12BrNO3
and a molecular weight of 346.18 g/mol. Its IUPAC name is 6-[3-(4-bromophenyl)prop-2-enoyl]-3,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 6-[3-(4-bromophenyl)prop-2-enoyl]-3,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile |
| PubChem CID | 67833194 |
| Molecular Formula | C16H12BrNO3 |
| Molecular Weight | 346.18 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 6-[3-(4-bromophenyl)prop-2-enoyl]-3,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile |
| SMILES | N#CC1C=C(O)C=CC1(O)C(=O)C=Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H12BrNO3/c17-13-4-1-11(2-5-13)3-6-15(20)16(21)8-7-14(19)9-12(16)10-18/h1-9,12,19,21H |
| InChIKey | CWYAUKVEZYVCAI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.18 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-[3-(4-bromophenyl)prop-2-enoyl]-3,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(4-bromophenyl)prop-2-enoyl]-3,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile?
The IUPAC name of 6-[3-(4-bromophenyl)prop-2-enoyl]-3,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile (CID 67833194) is 6-[3-(4-bromophenyl)prop-2-enoyl]-3,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile.
What is the SMILES notation for 6-[3-(4-bromophenyl)prop-2-enoyl]-3,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile?
The canonical SMILES for 6-[3-(4-bromophenyl)prop-2-enoyl]-3,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile is N#CC1C=C(O)C=CC1(O)C(=O)C=Cc1ccc(Br)cc1.
What is the InChIKey of 6-[3-(4-bromophenyl)prop-2-enoyl]-3,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile?
The InChIKey is CWYAUKVEZYVCAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12BrNO3/c17-13-4-1-11(2-5-13)3-6-15(20)16(21)8-7-14(19)9-12(16)10-18/h1-9,12,19,21H.
What are the key properties of 6-[3-(4-bromophenyl)prop-2-enoyl]-3,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile?
6-[3-(4-bromophenyl)prop-2-enoyl]-3,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile has a molecular weight of 346.18 g/mol, XLogP of 2.91, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(4-bromophenyl)prop-2-enoyl]-3,6-dihydroxycyclohexa-2,4-diene-1-carbonitrile is sourced from PubChem (CID 67833194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).