C26H40O2 — CID 67833427
(1R,2S,4S,6S,7S,10S)-6-hexoxy-14-methoxy-7-methylpentacyclo[8.8.0.02,7.04,6.011,16]octadeca-11(16),13-diene (PubChem CID 67833427) has the molecular formula C26H40O2 and a molecular weight of 384.60 g/mol. Its IUPAC name is (1R,2S,4S,6S,7S,10S)-6-hexoxy-14-methoxy-7-methylpentacyclo[8.8.0.02,7.04,6.011,16]octadeca-11(16),13-diene.
| Compound Name | (1R,2S,4S,6S,7S,10S)-6-hexoxy-14-methoxy-7-methylpentacyclo[8.8.0.02,7.04,6.011,16]octadeca-11(16),13-diene |
|---|---|
| PubChem CID | 67833427 |
| Molecular Formula | C26H40O2 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | (1R,2S,4S,6S,7S,10S)-6-hexoxy-14-methoxy-7-methylpentacyclo[8.8.0.02,7.04,6.011,16]octadeca-11(16),13-diene |
| SMILES | CCCCCCO[C@@]12C[C@@H]1C[C@H]1[C@@H]3CCC4=C(CC=C(OC)C4)[C@H]3CC[C@@]12C |
| InChI | InChI=1S/C26H40O2/c1-4-5-6-7-14-28-26-17-19(26)16-24-23-10-8-18-15-20(27-3)9-11-21(18)22(23)12-13-25(24,26)2/h9,19,22-24H,4-8,10-17H2,1-3H3/t19-,22+,23+,24-,25-,26-/m0/s1 |
| InChIKey | HHEIOSCVVBXLSV-CAVKYZKFSA-N |
| XLogP | 6.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|