About [(1S)-2-(2,3-dihydrobenzimidazol-1-yl)-1-(2H-tetrazol-5-yl)ethyl]carbamic acid
[(1S)-2-(2,3-dihydrobenzimidazol-1-yl)-1-(2H-tetrazol-5-yl)ethyl]carbamic acid (PubChem CID 67833476) has the molecular formula C11H13N7O2
and a molecular weight of 275.27 g/mol. Its IUPAC name is [(1S)-2-(2,3-dihydrobenzimidazol-1-yl)-1-(2H-tetrazol-5-yl)ethyl]carbamic acid.
Molecular Properties
| Compound Name | [(1S)-2-(2,3-dihydrobenzimidazol-1-yl)-1-(2H-tetrazol-5-yl)ethyl]carbamic acid |
| PubChem CID | 67833476 |
| Molecular Formula | C11H13N7O2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | [(1S)-2-(2,3-dihydrobenzimidazol-1-yl)-1-(2H-tetrazol-5-yl)ethyl]carbamic acid |
| SMILES | O=C(O)N[C@@H](CN1CNc2ccccc21)c1nn[nH]n1 |
| InChI | InChI=1S/C11H13N7O2/c19-11(20)13-8(10-14-16-17-15-10)5-18-6-12-7-3-1-2-4-9(7)18/h1-4,8,12-13H,5-6H2,(H,19,20)(H,14,15,16,17)/t8-/m0/s1 |
| InChIKey | RESAQDJEJVFFJL-QMMMGPOBSA-N |
| XLogP | 0.40 |
| TPSA | 119.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(1S)-2-(2,3-dihydrobenzimidazol-1-yl)-1-(2H-tetrazol-5-yl)ethyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-2-(2,3-dihydrobenzimidazol-1-yl)-1-(2H-tetrazol-5-yl)ethyl]carbamic acid?
The IUPAC name of [(1S)-2-(2,3-dihydrobenzimidazol-1-yl)-1-(2H-tetrazol-5-yl)ethyl]carbamic acid (CID 67833476) is [(1S)-2-(2,3-dihydrobenzimidazol-1-yl)-1-(2H-tetrazol-5-yl)ethyl]carbamic acid.
What is the SMILES notation for [(1S)-2-(2,3-dihydrobenzimidazol-1-yl)-1-(2H-tetrazol-5-yl)ethyl]carbamic acid?
The canonical SMILES for [(1S)-2-(2,3-dihydrobenzimidazol-1-yl)-1-(2H-tetrazol-5-yl)ethyl]carbamic acid is O=C(O)N[C@@H](CN1CNc2ccccc21)c1nn[nH]n1.
What is the InChIKey of [(1S)-2-(2,3-dihydrobenzimidazol-1-yl)-1-(2H-tetrazol-5-yl)ethyl]carbamic acid?
The InChIKey is RESAQDJEJVFFJL-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H13N7O2/c19-11(20)13-8(10-14-16-17-15-10)5-18-6-12-7-3-1-2-4-9(7)18/h1-4,8,12-13H,5-6H2,(H,19,20)(H,14,15,16,17)/t8-/m0/s1.
What are the key properties of [(1S)-2-(2,3-dihydrobenzimidazol-1-yl)-1-(2H-tetrazol-5-yl)ethyl]carbamic acid?
[(1S)-2-(2,3-dihydrobenzimidazol-1-yl)-1-(2H-tetrazol-5-yl)ethyl]carbamic acid has a molecular weight of 275.27 g/mol, XLogP of 0.40, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-2-(2,3-dihydrobenzimidazol-1-yl)-1-(2H-tetrazol-5-yl)ethyl]carbamic acid is sourced from PubChem (CID 67833476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).