About [1-[3,6-bis(diethylamino)-2-pyridinyl]piperazin-2-yl]-pyrrolidin-2-ylmethanone
[1-[3,6-bis(diethylamino)-2-pyridinyl]piperazin-2-yl]-pyrrolidin-2-ylmethanone (PubChem CID 67833558) has the molecular formula C22H38N6O
and a molecular weight of 402.59 g/mol. Its IUPAC name is [1-[3,6-bis(diethylamino)-2-pyridinyl]piperazin-2-yl]-pyrrolidin-2-ylmethanone.
Molecular Properties
| Compound Name | [1-[3,6-bis(diethylamino)-2-pyridinyl]piperazin-2-yl]-pyrrolidin-2-ylmethanone |
| PubChem CID | 67833558 |
| Molecular Formula | C22H38N6O |
| Molecular Weight | 402.59 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | [1-[3,6-bis(diethylamino)-2-pyridinyl]piperazin-2-yl]-pyrrolidin-2-ylmethanone |
| SMILES | CCN(CC)c1ccc(N(CC)CC)c(N2CCNCC2C(=O)C2CCCN2)n1 |
| InChI | InChI=1S/C22H38N6O/c1-5-26(6-2)18-11-12-20(27(7-3)8-4)25-22(18)28-15-14-23-16-19(28)21(29)17-10-9-13-24-17/h11-12,17,19,23-24H,5-10,13-16H2,1-4H3 |
| InChIKey | GLVKDSQCCNILCR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.59 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [1-[3,6-bis(diethylamino)-2-pyridinyl]piperazin-2-yl]-pyrrolidin-2-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[3,6-bis(diethylamino)-2-pyridinyl]piperazin-2-yl]-pyrrolidin-2-ylmethanone?
The IUPAC name of [1-[3,6-bis(diethylamino)-2-pyridinyl]piperazin-2-yl]-pyrrolidin-2-ylmethanone (CID 67833558) is [1-[3,6-bis(diethylamino)-2-pyridinyl]piperazin-2-yl]-pyrrolidin-2-ylmethanone.
What is the SMILES notation for [1-[3,6-bis(diethylamino)-2-pyridinyl]piperazin-2-yl]-pyrrolidin-2-ylmethanone?
The canonical SMILES for [1-[3,6-bis(diethylamino)-2-pyridinyl]piperazin-2-yl]-pyrrolidin-2-ylmethanone is CCN(CC)c1ccc(N(CC)CC)c(N2CCNCC2C(=O)C2CCCN2)n1.
What is the InChIKey of [1-[3,6-bis(diethylamino)-2-pyridinyl]piperazin-2-yl]-pyrrolidin-2-ylmethanone?
The InChIKey is GLVKDSQCCNILCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H38N6O/c1-5-26(6-2)18-11-12-20(27(7-3)8-4)25-22(18)28-15-14-23-16-19(28)21(29)17-10-9-13-24-17/h11-12,17,19,23-24H,5-10,13-16H2,1-4H3.
What are the key properties of [1-[3,6-bis(diethylamino)-2-pyridinyl]piperazin-2-yl]-pyrrolidin-2-ylmethanone?
[1-[3,6-bis(diethylamino)-2-pyridinyl]piperazin-2-yl]-pyrrolidin-2-ylmethanone has a molecular weight of 402.59 g/mol, XLogP of 1.87, 9 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[3,6-bis(diethylamino)-2-pyridinyl]piperazin-2-yl]-pyrrolidin-2-ylmethanone is sourced from PubChem (CID 67833558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).