C35H40N2O8 — CID 67833961
2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid;(3R)-N-[(1S)-1-phenylethyl]-1-azabicyclo[2.2.2]octan-3-amine (PubChem CID 67833961) has the molecular formula C35H40N2O8 and a molecular weight of 616.71 g/mol. Its IUPAC name is 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid;(3R)-N-[(1S)-1-phenylethyl]-1-azabicyclo[2.2.2]octan-3-amine.
| Compound Name | 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid;(3R)-N-[(1S)-1-phenylethyl]-1-azabicyclo[2.2.2]octan-3-amine |
|---|---|
| PubChem CID | 67833961 |
| Molecular Formula | C35H40N2O8 |
| Molecular Weight | 616.71 g/mol |
| Exact Mass | 616.28 |
| IUPAC Name | 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid;(3R)-N-[(1S)-1-phenylethyl]-1-azabicyclo[2.2.2]octan-3-amine |
| SMILES | C[C@H](N[C@H]1CN2CCC1CC2)c1ccccc1.Cc1ccc(C(=O)C(O)(C(=O)O)C(O)(C(=O)O)C(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H18O8.C15H22N2/c1-11-3-7-13(8-4-11)15(21)19(27,17(23)24)20(28,18(25)26)16(22)14-9-5-12(2)6-10-14;1-12(13-5-3-2-4-6-13)16-15-11-17-9-7-14(15)8-10-17/h3-10,27-28H,1-2H3,(H,23,24)(H,25,26);2-6,12,14-16H,7-11H2,1H3/t;12-,15-/m.0/s1 |
| InChIKey | UEWCVIHUNRINMM-VXPKHCQKSA-N |
| XLogP | 3.43 |
| TPSA | 164.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.71 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|