C52H46N4O8 — CID 67834068
2-[2-[2,3,21-tris[2-(2-hydroxyethoxy)phenyl]-23H-porphyrin-5-yl]phenoxy]ethanol (PubChem CID 67834068) has the molecular formula C52H46N4O8 and a molecular weight of 854.96 g/mol. Its IUPAC name is 2-[2-[2,3,21-tris[2-(2-hydroxyethoxy)phenyl]-23H-porphyrin-5-yl]phenoxy]ethanol.
| Compound Name | 2-[2-[2,3,21-tris[2-(2-hydroxyethoxy)phenyl]-23H-porphyrin-5-yl]phenoxy]ethanol |
|---|---|
| PubChem CID | 67834068 |
| Molecular Formula | C52H46N4O8 |
| Molecular Weight | 854.96 g/mol |
| Exact Mass | 854.33 |
| IUPAC Name | 2-[2-[2,3,21-tris[2-(2-hydroxyethoxy)phenyl]-23H-porphyrin-5-yl]phenoxy]ethanol |
| SMILES | OCCOc1ccccc1-c1c(-c2ccccc2OCCO)c2c(-c3ccccc3OCCO)c3nc(cc4ccc(cc5nc(cc1n2-c1ccccc1OCCO)C=C5)[nH]4)C=C3 |
| InChI | InChI=1S/C52H46N4O8/c57-23-27-61-45-13-5-1-9-39(45)49-42-22-21-37(55-42)32-36-18-17-34(53-36)31-35-19-20-38(54-35)33-44-50(40-10-2-6-14-46(40)62-28-24-58)51(41-11-3-7-15-47(41)63-29-25-59)52(49)56(44)43-12-4-8-16-48(43)64-30-26-60/h1-22,31-33,53,57-60H,23-30H2/b34-31-,35-31-,36-32-,37-32-,38-33-,44-33-,49-42-,52-49- |
| InChIKey | HOQHRXZOLSZMNY-IWEODRMDSA-N |
| XLogP | 8.60 |
| TPSA | 164.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.96 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |