C12H32O5Si4 — CID 67834195
2-(1-ethoxypropyl)-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 67834195) has the molecular formula C12H32O5Si4 and a molecular weight of 368.73 g/mol. Its IUPAC name is 2-(1-ethoxypropyl)-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2-(1-ethoxypropyl)-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 67834195 |
| Molecular Formula | C12H32O5Si4 |
| Molecular Weight | 368.73 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-(1-ethoxypropyl)-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | CCOC(CC)[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C12H32O5Si4/c1-10-12(13-11-2)21(9)16-19(5,6)14-18(3,4)15-20(7,8)17-21/h12H,10-11H2,1-9H3 |
| InChIKey | QHFYANUMEPMJSL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.73 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|