About 1,2-benzoxazol-7-ol;ethane
1,2-benzoxazol-7-ol;ethane (PubChem CID 67834211) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 1,2-benzoxazol-7-ol;ethane.
Molecular Properties
| Compound Name | 1,2-benzoxazol-7-ol;ethane |
| PubChem CID | 67834211 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 1,2-benzoxazol-7-ol;ethane |
| SMILES | CC.Oc1cccc2cnoc12 |
| InChI | InChI=1S/C7H5NO2.C2H6/c9-6-3-1-2-5-4-8-10-7(5)6;1-2/h1-4,9H;1-2H3 |
| InChIKey | FKZRQMYZSXEVPO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2-benzoxazol-7-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-benzoxazol-7-ol;ethane?
The IUPAC name of 1,2-benzoxazol-7-ol;ethane (CID 67834211) is 1,2-benzoxazol-7-ol;ethane.
What is the SMILES notation for 1,2-benzoxazol-7-ol;ethane?
The canonical SMILES for 1,2-benzoxazol-7-ol;ethane is CC.Oc1cccc2cnoc12.
What is the InChIKey of 1,2-benzoxazol-7-ol;ethane?
The InChIKey is FKZRQMYZSXEVPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO2.C2H6/c9-6-3-1-2-5-4-8-10-7(5)6;1-2/h1-4,9H;1-2H3.
What are the key properties of 1,2-benzoxazol-7-ol;ethane?
1,2-benzoxazol-7-ol;ethane has a molecular weight of 165.19 g/mol, XLogP of 2.56, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-benzoxazol-7-ol;ethane is sourced from PubChem (CID 67834211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).