C22H23N3O3S — CID 67834234
tert-butyl 3-(2-pyridin-3-yl-1,2-thiazolidine-4-carbonyl)-1H-indole-2-carboxylate (PubChem CID 67834234) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is tert-butyl 3-(2-pyridin-3-yl-1,2-thiazolidine-4-carbonyl)-1H-indole-2-carboxylate.
| Compound Name | tert-butyl 3-(2-pyridin-3-yl-1,2-thiazolidine-4-carbonyl)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 67834234 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | tert-butyl 3-(2-pyridin-3-yl-1,2-thiazolidine-4-carbonyl)-1H-indole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1[nH]c2ccccc2c1C(=O)C1CSN(c2cccnc2)C1 |
| InChI | InChI=1S/C22H23N3O3S/c1-22(2,3)28-21(27)19-18(16-8-4-5-9-17(16)24-19)20(26)14-12-25(29-13-14)15-7-6-10-23-11-15/h4-11,14,24H,12-13H2,1-3H3 |
| InChIKey | XJCXHAUHPMSVHL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|